학술논문
71A-2 AOBACPC and analogues: 71A-2(A) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH3 [F], 71A-2(B) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH(CH3)C2H5 [F], 71A-2(C) CnH2n+1O--CH=N--CH=C (CH3)COOCH2CHClCH(CH3)C2H5 [F], 71A-2(D) CnH2n+1O--CH=N--CH=CHCOOCH2CHBrCH(CH3)C2H5 [F], 71A-2(E) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH2CH(CH3)2 [F], 71A-2(F) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH(CH3)2 [F], 71A-2(G) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH2-, 71A-2(H) CnH2n+1O--CH=N--CH=CHCOOCH2CH2CHClCH3 [F], 71A-2(I) CnH2n+1O--CH=N--CH=C(CN)COOCH2CH(CH3)C2H5 [F], 71A-2(J) CnH2n+1O--CH=N--CH=CClCOOCH2CH(CH3)C2H5 [F] : 71A Ferroelectric liquid crystals, 71 Ferroelectric and antiferroelectric liquid crystals, Liquid crystals
Document Type
Chapter
Author
Shiozaki, Y., Editor; Nakamura, E., Editor; Mitsui, T., Editor; Takezoe, H.; Ishibashi, Y.; Nozaki, R.; Nakamura, E.; Martienssen, W., Editor-in-Chief
Source
Organic crystals, liquid crystals and polymers. 01/01/2006. 36C:1-12
Subject
Language
English
ISSN
1615-1925
1616-9549
1616-9549
Abstract
This document is part of Subvolume C 'Organic crystals, liquid crystals and polymers' of Volume 36 'Ferroelectrics and Related Substances' of Landolt-Börnstein - Group III 'Condensed Matter'.
It contains the following properties of the ferroelectric liquid crystals AOBACPC and analogues
1 Fundamentals, 3 Crystal structure, 5 Dielectric properties, 6 Thermal properties, 9 Optical properties of 71A-2(A) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH3 [F] (AOBACPC (p-alkoxybenzylidene p'-amino-2-chloropropyl cinnamate))
n = 6: HOBACPC (p-hexyloxybenzylidene p'-amino-2-chloropropyl cinnamate)
n = 8: OOBACPC (p-octyloxybenzylidene p'-amino-2-chloropropyl cinnamate)
n = 10: DOBACPC (p-decyloxybenzylidene p'-amino-2-chloropropyl cinnamate)
contained elements: C-Cl-H-N-O
1 Fundamentals, 5 Dielectric properties of 71A-2(B) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH(CH3)C2H5 [F] (AOBAC-3-MPC ((2S,3S)-p-alkoxybenzylidene p'-amino-2-chloro-3-methylpentyl cinnamate))
n = 1: MOBAC-3-MPC
n = 5: POBAC-3-MPC
n = 6: HOBAC-3-MPC
n = 10: DOBAC-3-MPC
n = 14: TDOBAC-3-MPC
1 Fundamentals of 71A-2(C) CnH2n+1O--CH=N--CH=C (CH3)COOCH2CHClCH(CH3)C2H5 [F] (AOBAC-3-MPCM ((2S,3S)-p-alkoxybenzylidene p'-amino-2-chloro-3-methylpentyl-methyl cinnamate))
n = 10: DOBAC-3-MPCM
1 Fundamentals of 71A-2(D) CnH2n+1O--CH=N--CH=CHCOOCH2CHBrCH(CH3)C2H5 [F] (AOBAB-3-MPC ((2S,3S)-p-alkoxybenzylidene p'-amino-2-bromo-3-methylpentyl cinnamate))
n = 10: DOBAB-3-MPC
contained elements: Br-C-H-N-O
1 Fundamentals of 71A-2(E) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH2CH(CH3)2 [F] (AOBAC-4-MPC ((2S)-p-alkoxybenzylidene p'-amino-2-chloro-4-methylpentyl cinnamate))
n = 5: POBAC-4-MPC
n = 6: HOBAC-4-MPC
n = 10: DOBAC-4-MPC
n = 14: TDOBAC-4-MPC
n = 18: ODOBAC-4-MPC
1 Fundamentals of 71A-2(F) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH(CH3)2 [F] (AOBAC-3-MBC ((2S)-p-alkoxybenzylidene p'-amino-2-chloro-3-methylbutyl cinnamate))
n = 5: POBAC-3-MBC
n = 6: HOBAC-3-MBC
n = 10: DOBAC-3-MBC
n = 14: TDOBAC-3-MBC
1 Fundamentals of 71A-2(G) CnH2n+1O--CH=N--CH=CHCOOCH2CHClCH2- (AOBAC-3-PPC ((2S)-p-alkoxybenzylidene p'-amino-2-chloro-3-phenylpropyl cinnamate))
n = 10: DOBAC-3-PPC
1 Fundamentals of 71A-2(H) CnH2n+1O--CH=N--CH=CHCOOCH2CH2CHClCH3 [F] (AOBA-3-CBC ((3S)-p-alkoxybenzylidene p'-amino-3-chlorobutyl cinnamate))
n = 10: DOBA-3-CBC
1 Fundamentals, 3 Crystal structure of 71A-2(I) CnH2n+1O--CH=N--CH=C(CN)COOCH2CH(CH3)C2H5 [F] (AOBAMBCC (p-alkoxybenzylidene-p'-amino-2-methylbutyl-cyano cinnamate))
n = 10: DOBAMBCC (p-decyloxybenzylidene-p'-amino-2-methylbutyl-cyano cinnamate)
n = 14: TDOBAMBCC (p-tetradecyloxybenzylidene-p'-amino-2-methylbutyl-cyano cinnamate)
contained elements: C-H-N-O
1 Fundamentals of 71A-2(J) CnH2n+1O--CH=N--CH=CClCOOCH2CH(CH3)C2H5 [F] (AOBAMBClC (p-alkoxybenzylidene-p'-amino-2-methylbutyl-chloro cinnamate))
contained elements: C-Cl-H-N-O.
Contained figures: Figs. 71A-2-001 to 71A-2-015.
It contains the following properties of the ferroelectric liquid crystals AOBACPC and analogues
1 Fundamentals, 3 Crystal structure, 5 Dielectric properties, 6 Thermal properties, 9 Optical properties of 71A-2(A) CnH2n+1O-
n = 6: HOBACPC (p-hexyloxybenzylidene p'-amino-2-chloropropyl cinnamate)
n = 8: OOBACPC (p-octyloxybenzylidene p'-amino-2-chloropropyl cinnamate)
n = 10: DOBACPC (p-decyloxybenzylidene p'-amino-2-chloropropyl cinnamate)
contained elements: C-Cl-H-N-O
1 Fundamentals, 5 Dielectric properties of 71A-2(B) CnH2n+1O-
n = 1: MOBAC-3-MPC
n = 5: POBAC-3-MPC
n = 6: HOBAC-3-MPC
n = 10: DOBAC-3-MPC
n = 14: TDOBAC-3-MPC
1 Fundamentals of 71A-2(C) CnH2n+1O-
n = 10: DOBAC-3-MPCM
1 Fundamentals of 71A-2(D) CnH2n+1O-
n = 10: DOBAB-3-MPC
contained elements: Br-C-H-N-O
1 Fundamentals of 71A-2(E) CnH2n+1O-
n = 5: POBAC-4-MPC
n = 6: HOBAC-4-MPC
n = 10: DOBAC-4-MPC
n = 14: TDOBAC-4-MPC
n = 18: ODOBAC-4-MPC
1 Fundamentals of 71A-2(F) CnH2n+1O-
n = 5: POBAC-3-MBC
n = 6: HOBAC-3-MBC
n = 10: DOBAC-3-MBC
n = 14: TDOBAC-3-MBC
1 Fundamentals of 71A-2(G) CnH2n+1O-
n = 10: DOBAC-3-PPC
1 Fundamentals of 71A-2(H) CnH2n+1O-
n = 10: DOBA-3-CBC
1 Fundamentals, 3 Crystal structure of 71A-2(I) CnH2n+1O-
n = 10: DOBAMBCC (p-decyloxybenzylidene-p'-amino-2-methylbutyl-cyano cinnamate)
n = 14: TDOBAMBCC (p-tetradecyloxybenzylidene-p'-amino-2-methylbutyl-cyano cinnamate)
contained elements: C-H-N-O
1 Fundamentals of 71A-2(J) CnH2n+1O-
contained elements: C-Cl-H-N-O.
Contained figures: Figs. 71A-2-001 to 71A-2-015.